C12H10F2N4O2 — CID 122301482
1-(2,5-difluorophenyl)-3-(2-methoxypyrimidin-5-yl)urea (PubChem CID 122301482) has the molecular formula C12H10F2N4O2 and a molecular weight of 280.23 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-(2-methoxypyrimidin-5-yl)urea.
| Compound Name | 1-(2,5-difluorophenyl)-3-(2-methoxypyrimidin-5-yl)urea |
|---|---|
| PubChem CID | 122301482 |
| Molecular Formula | C12H10F2N4O2 |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-(2-methoxypyrimidin-5-yl)urea |
| SMILES | COc1ncc(NC(=O)Nc2cc(F)ccc2F)cn1 |
| InChI | InChI=1S/C12H10F2N4O2/c1-20-12-15-5-8(6-16-12)17-11(19)18-10-4-7(13)2-3-9(10)14/h2-6H,1H3,(H2,17,18,19) |
| InChIKey | PFBWUHTUYZAEHS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |