C14H10F2N6O — CID 122300777
1-(2,5-difluorophenyl)-3-(2-imidazol-1-ylpyrimidin-5-yl)urea (PubChem CID 122300777) has the molecular formula C14H10F2N6O and a molecular weight of 316.27 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-(2-imidazol-1-ylpyrimidin-5-yl)urea.
| Compound Name | 1-(2,5-difluorophenyl)-3-(2-imidazol-1-ylpyrimidin-5-yl)urea |
|---|---|
| PubChem CID | 122300777 |
| Molecular Formula | C14H10F2N6O |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-(2-imidazol-1-ylpyrimidin-5-yl)urea |
| SMILES | O=C(Nc1cnc(-n2ccnc2)nc1)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C14H10F2N6O/c15-9-1-2-11(16)12(5-9)21-14(23)20-10-6-18-13(19-7-10)22-4-3-17-8-22/h1-8H,(H2,20,21,23) |
| InChIKey | PHMCTELDDSDOFX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |