C16H12F2N4O — CID 12911664
1-(2,4-difluorophenyl)-3-(2-imidazol-1-ylphenyl)urea (PubChem CID 12911664) has the molecular formula C16H12F2N4O and a molecular weight of 314.30 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(2-imidazol-1-ylphenyl)urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(2-imidazol-1-ylphenyl)urea |
|---|---|
| PubChem CID | 12911664 |
| Molecular Formula | C16H12F2N4O |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(2-imidazol-1-ylphenyl)urea |
| SMILES | O=C(Nc1ccc(F)cc1F)Nc1ccccc1-n1ccnc1 |
| InChI | InChI=1S/C16H12F2N4O/c17-11-5-6-13(12(18)9-11)20-16(23)21-14-3-1-2-4-15(14)22-8-7-19-10-22/h1-10H,(H2,20,21,23) |
| InChIKey | VPCDGKRVLMZSKE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |