C12H10F2N4O — CID 63062599
1-(3-amino-4-pyridinyl)-3-(2,4-difluorophenyl)urea (PubChem CID 63062599) has the molecular formula C12H10F2N4O and a molecular weight of 264.24 g/mol. Its IUPAC name is 1-(3-amino-4-pyridinyl)-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-(3-amino-4-pyridinyl)-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 63062599 |
| Molecular Formula | C12H10F2N4O |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 1-(3-amino-4-pyridinyl)-3-(2,4-difluorophenyl)urea |
| SMILES | Nc1cnccc1NC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C12H10F2N4O/c13-7-1-2-10(8(14)5-7)17-12(19)18-11-3-4-16-6-9(11)15/h1-6H,15H2,(H2,16,17,18,19) |
| InChIKey | BEKYCSPHDSHXDQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |