C10H9F2N5O2 — CID 83101976
1-(2,4-difluorophenyl)-3-(3-methoxy-1H-1,2,4-triazol-5-yl)urea (PubChem CID 83101976) has the molecular formula C10H9F2N5O2 and a molecular weight of 269.21 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(3-methoxy-1H-1,2,4-triazol-5-yl)urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(3-methoxy-1H-1,2,4-triazol-5-yl)urea |
|---|---|
| PubChem CID | 83101976 |
| Molecular Formula | C10H9F2N5O2 |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(3-methoxy-1H-1,2,4-triazol-5-yl)urea |
| SMILES | COc1n[nH]c(NC(=O)Nc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C10H9F2N5O2/c1-19-10-15-8(16-17-10)14-9(18)13-7-3-2-5(11)4-6(7)12/h2-4H,1H3,(H3,13,14,15,16,17,18) |
| InChIKey | FPLMXTPIMAZPDW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |