C15H11Cl2F3N4O3 — CID 166747484
1-(3,5-dichlorophenyl)-3-[2-(hydrazinecarbonyl)-5-(trifluoromethoxy)phenyl]urea (PubChem CID 166747484) has the molecular formula C15H11Cl2F3N4O3 and a molecular weight of 423.18 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-[2-(hydrazinecarbonyl)-5-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-[2-(hydrazinecarbonyl)-5-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 166747484 |
| Molecular Formula | C15H11Cl2F3N4O3 |
| Molecular Weight | 423.18 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-[2-(hydrazinecarbonyl)-5-(trifluoromethoxy)phenyl]urea |
| SMILES | NNC(=O)c1ccc(OC(F)(F)F)cc1NC(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H11Cl2F3N4O3/c16-7-3-8(17)5-9(4-7)22-14(26)23-12-6-10(27-15(18,19)20)1-2-11(12)13(25)24-21/h1-6H,21H2,(H,24,25)(H2,22,23,26) |
| InChIKey | LQUNIAATLKGWGU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.18 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|