C17H14Br2F3N3O3 — CID 156854258
2-[(3,5-dibromophenyl)carbamoylamino]-N-ethyl-4-(trifluoromethoxy)benzamide (PubChem CID 156854258) has the molecular formula C17H14Br2F3N3O3 and a molecular weight of 525.12 g/mol. Its IUPAC name is 2-[(3,5-dibromophenyl)carbamoylamino]-N-ethyl-4-(trifluoromethoxy)benzamide.
| Compound Name | 2-[(3,5-dibromophenyl)carbamoylamino]-N-ethyl-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 156854258 |
| Molecular Formula | C17H14Br2F3N3O3 |
| Molecular Weight | 525.12 g/mol |
| Exact Mass | 522.94 |
| IUPAC Name | 2-[(3,5-dibromophenyl)carbamoylamino]-N-ethyl-4-(trifluoromethoxy)benzamide |
| SMILES | CCNC(=O)c1ccc(OC(F)(F)F)cc1NC(=O)Nc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C17H14Br2F3N3O3/c1-2-23-15(26)13-4-3-12(28-17(20,21)22)8-14(13)25-16(27)24-11-6-9(18)5-10(19)7-11/h3-8H,2H2,1H3,(H,23,26)(H2,24,25,27) |
| InChIKey | BLPAWZUSAUTJNT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.12 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |