C9H9F3N4O3 — CID 166747520
[2-(hydrazinecarbonyl)-5-(trifluoromethoxy)phenyl]urea (PubChem CID 166747520) has the molecular formula C9H9F3N4O3 and a molecular weight of 278.19 g/mol. Its IUPAC name is [2-(hydrazinecarbonyl)-5-(trifluoromethoxy)phenyl]urea.
| Compound Name | [2-(hydrazinecarbonyl)-5-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 166747520 |
| Molecular Formula | C9H9F3N4O3 |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | [2-(hydrazinecarbonyl)-5-(trifluoromethoxy)phenyl]urea |
| SMILES | NNC(=O)c1ccc(OC(F)(F)F)cc1NC(N)=O |
| InChI | InChI=1S/C9H9F3N4O3/c10-9(11,12)19-4-1-2-5(7(17)16-14)6(3-4)15-8(13)18/h1-3H,14H2,(H,16,17)(H3,13,15,18) |
| InChIKey | XWVGPFLUWNVYAY-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|