C9H6F3N3O2S — CID 121230751
[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]urea (PubChem CID 121230751) has the molecular formula C9H6F3N3O2S and a molecular weight of 277.23 g/mol. Its IUPAC name is [6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]urea.
| Compound Name | [6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]urea |
|---|---|
| PubChem CID | 121230751 |
| Molecular Formula | C9H6F3N3O2S |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | [6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]urea |
| SMILES | NC(=O)Nc1nc2ccc(OC(F)(F)F)cc2s1 |
| InChI | InChI=1S/C9H6F3N3O2S/c10-9(11,12)17-4-1-2-5-6(3-4)18-8(14-5)15-7(13)16/h1-3H,(H3,13,14,15,16) |
| InChIKey | OYIGUOBSFOCBGL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |