C11H8ClF3N2O3S — CID 118029905
1-chloroethyl N-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]carbamate (PubChem CID 118029905) has the molecular formula C11H8ClF3N2O3S and a molecular weight of 340.71 g/mol. Its IUPAC name is 1-chloroethyl N-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]carbamate.
| Compound Name | 1-chloroethyl N-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 118029905 |
| Molecular Formula | C11H8ClF3N2O3S |
| Molecular Weight | 340.71 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 1-chloroethyl N-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]carbamate |
| SMILES | CC(Cl)OC(=O)Nc1nc2ccc(OC(F)(F)F)cc2s1 |
| InChI | InChI=1S/C11H8ClF3N2O3S/c1-5(12)19-10(18)17-9-16-7-3-2-6(4-8(7)21-9)20-11(13,14)15/h2-5H,1H3,(H,16,17,18) |
| InChIKey | VVJBQQIRCKLEID-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.71 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|