C12H13F3N2OS — CID 134241624
N-tert-butyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-amine (PubChem CID 134241624) has the molecular formula C12H13F3N2OS and a molecular weight of 290.31 g/mol. Its IUPAC name is N-tert-butyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-amine.
| Compound Name | N-tert-butyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 134241624 |
| Molecular Formula | C12H13F3N2OS |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | N-tert-butyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-amine |
| SMILES | CC(C)(C)Nc1nc2ccc(OC(F)(F)F)cc2s1 |
| InChI | InChI=1S/C12H13F3N2OS/c1-11(2,3)17-10-16-8-5-4-7(6-9(8)19-10)18-12(13,14)15/h4-6H,1-3H3,(H,16,17) |
| InChIKey | MWBBNXYJRQLRCJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |