C11H11F3N2OS — CID 118215837
N-propan-2-yl-6-(trifluoromethoxy)-1,3-benzothiazol-2-amine (PubChem CID 118215837) has the molecular formula C11H11F3N2OS and a molecular weight of 276.28 g/mol. Its IUPAC name is N-propan-2-yl-6-(trifluoromethoxy)-1,3-benzothiazol-2-amine.
| Compound Name | N-propan-2-yl-6-(trifluoromethoxy)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 118215837 |
| Molecular Formula | C11H11F3N2OS |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | N-propan-2-yl-6-(trifluoromethoxy)-1,3-benzothiazol-2-amine |
| SMILES | CC(C)Nc1nc2ccc(OC(F)(F)F)cc2s1 |
| InChI | InChI=1S/C11H11F3N2OS/c1-6(2)15-10-16-8-4-3-7(5-9(8)18-10)17-11(12,13)14/h3-6H,1-2H3,(H,15,16) |
| InChIKey | ICUOCCAJUMONNE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |