C11H14N2OS — CID 78908950
6-methoxy-N-propan-2-yl-1,3-benzothiazol-2-amine (PubChem CID 78908950) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is 6-methoxy-N-propan-2-yl-1,3-benzothiazol-2-amine.
| Compound Name | 6-methoxy-N-propan-2-yl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 78908950 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 6-methoxy-N-propan-2-yl-1,3-benzothiazol-2-amine |
| SMILES | COc1ccc2nc(NC(C)C)sc2c1 |
| InChI | InChI=1S/C11H14N2OS/c1-7(2)12-11-13-9-5-4-8(14-3)6-10(9)15-11/h4-7H,1-3H3,(H,12,13) |
| InChIKey | VXORATMQCHDRMV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |