C12H16N2O2S — CID 82105841
4,6-dimethoxy-N-propan-2-yl-1,3-benzothiazol-2-amine (PubChem CID 82105841) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 4,6-dimethoxy-N-propan-2-yl-1,3-benzothiazol-2-amine.
| Compound Name | 4,6-dimethoxy-N-propan-2-yl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82105841 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 4,6-dimethoxy-N-propan-2-yl-1,3-benzothiazol-2-amine |
| SMILES | COc1cc(OC)c2nc(NC(C)C)sc2c1 |
| InChI | InChI=1S/C12H16N2O2S/c1-7(2)13-12-14-11-9(16-4)5-8(15-3)6-10(11)17-12/h5-7H,1-4H3,(H,13,14) |
| InChIKey | GPJQFDUGHCZCSI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |