C12H11N3O2S2 — CID 43968726
4,6-dimethoxy-N-(1,3-thiazol-2-yl)-1,3-benzothiazol-2-amine (PubChem CID 43968726) has the molecular formula C12H11N3O2S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 4,6-dimethoxy-N-(1,3-thiazol-2-yl)-1,3-benzothiazol-2-amine.
| Compound Name | 4,6-dimethoxy-N-(1,3-thiazol-2-yl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 43968726 |
| Molecular Formula | C12H11N3O2S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 4,6-dimethoxy-N-(1,3-thiazol-2-yl)-1,3-benzothiazol-2-amine |
| SMILES | COc1cc(OC)c2nc(Nc3nccs3)sc2c1 |
| InChI | InChI=1S/C12H11N3O2S2/c1-16-7-5-8(17-2)10-9(6-7)19-12(14-10)15-11-13-3-4-18-11/h3-6H,1-2H3,(H,13,14,15) |
| InChIKey | GQZYSSONRTXWCX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |