C10H12N2O2S — CID 82105804
4,6-dimethoxy-N-methyl-1,3-benzothiazol-2-amine (PubChem CID 82105804) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 4,6-dimethoxy-N-methyl-1,3-benzothiazol-2-amine.
| Compound Name | 4,6-dimethoxy-N-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82105804 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 4,6-dimethoxy-N-methyl-1,3-benzothiazol-2-amine |
| SMILES | CNc1nc2c(OC)cc(OC)cc2s1 |
| InChI | InChI=1S/C10H12N2O2S/c1-11-10-12-9-7(14-3)4-6(13-2)5-8(9)15-10/h4-5H,1-3H3,(H,11,12) |
| InChIKey | VYCCPCBRLLAOTL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |