C9H11N3O2S — CID 5228893
(4,6-dimethoxy-1,3-benzothiazol-2-yl)hydrazine (PubChem CID 5228893) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is (4,6-dimethoxy-1,3-benzothiazol-2-yl)hydrazine.
| Compound Name | (4,6-dimethoxy-1,3-benzothiazol-2-yl)hydrazine |
|---|---|
| PubChem CID | 5228893 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | (4,6-dimethoxy-1,3-benzothiazol-2-yl)hydrazine |
| SMILES | COc1cc(OC)c2nc(NN)sc2c1 |
| InChI | InChI=1S/C9H11N3O2S/c1-13-5-3-6(14-2)8-7(4-5)15-9(11-8)12-10/h3-4H,10H2,1-2H3,(H,11,12) |
| InChIKey | VUQXCUAFYDHYRJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|