C10H10N2O3S — CID 131858263
4,6-dimethoxy-1,3-benzothiazole-2-carboxamide (PubChem CID 131858263) has the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. Its IUPAC name is 4,6-dimethoxy-1,3-benzothiazole-2-carboxamide.
| Compound Name | 4,6-dimethoxy-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 131858263 |
| Molecular Formula | C10H10N2O3S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 4,6-dimethoxy-1,3-benzothiazole-2-carboxamide |
| SMILES | COc1cc(OC)c2nc(C(N)=O)sc2c1 |
| InChI | InChI=1S/C10H10N2O3S/c1-14-5-3-6(15-2)8-7(4-5)16-10(12-8)9(11)13/h3-4H,1-2H3,(H2,11,13) |
| InChIKey | ZXOMGFJAPCGSRL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |