C12H13N3O3S2 — CID 3297361
N-[(4,6-dimethoxy-1,3-benzothiazol-2-yl)carbamothioyl]acetamide (PubChem CID 3297361) has the molecular formula C12H13N3O3S2 and a molecular weight of 311.39 g/mol. Its IUPAC name is N-[(4,6-dimethoxy-1,3-benzothiazol-2-yl)carbamothioyl]acetamide.
| Compound Name | N-[(4,6-dimethoxy-1,3-benzothiazol-2-yl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3297361 |
| Molecular Formula | C12H13N3O3S2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | N-[(4,6-dimethoxy-1,3-benzothiazol-2-yl)carbamothioyl]acetamide |
| SMILES | COc1cc(OC)c2nc(NC(=S)NC(C)=O)sc2c1 |
| InChI | InChI=1S/C12H13N3O3S2/c1-6(16)13-11(19)15-12-14-10-8(18-3)4-7(17-2)5-9(10)20-12/h4-5H,1-3H3,(H2,13,14,15,16,19) |
| InChIKey | XGVLYIGUGNASGH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|