C23H20N2O3S — CID 3324697
N-(4,6-dimethoxy-1,3-benzothiazol-2-yl)-2,2-diphenylacetamide (PubChem CID 3324697) has the molecular formula C23H20N2O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is N-(4,6-dimethoxy-1,3-benzothiazol-2-yl)-2,2-diphenylacetamide.
| Compound Name | N-(4,6-dimethoxy-1,3-benzothiazol-2-yl)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 3324697 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | N-(4,6-dimethoxy-1,3-benzothiazol-2-yl)-2,2-diphenylacetamide |
| SMILES | COc1cc(OC)c2nc(NC(=O)C(c3ccccc3)c3ccccc3)sc2c1 |
| InChI | InChI=1S/C23H20N2O3S/c1-27-17-13-18(28-2)21-19(14-17)29-23(24-21)25-22(26)20(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-14,20H,1-2H3,(H,24,25,26) |
| InChIKey | PAUUBAKOWIGIJH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |