C21H16N2O3S — CID 164625974
N-(5,6-dihydroxy-1,3-benzothiazol-2-yl)-2,2-diphenylacetamide (PubChem CID 164625974) has the molecular formula C21H16N2O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is N-(5,6-dihydroxy-1,3-benzothiazol-2-yl)-2,2-diphenylacetamide.
| Compound Name | N-(5,6-dihydroxy-1,3-benzothiazol-2-yl)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 164625974 |
| Molecular Formula | C21H16N2O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | N-(5,6-dihydroxy-1,3-benzothiazol-2-yl)-2,2-diphenylacetamide |
| SMILES | O=C(Nc1nc2cc(O)c(O)cc2s1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H16N2O3S/c24-16-11-15-18(12-17(16)25)27-21(22-15)23-20(26)19(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12,19,24-25H,(H,22,23,26) |
| InChIKey | NLAWXYMTUMBOBQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|