C21H15N3O3S — CID 2433919
N-(6-nitro-1,3-benzothiazol-2-yl)-2,2-diphenylacetamide (PubChem CID 2433919) has the molecular formula C21H15N3O3S and a molecular weight of 389.44 g/mol. Its IUPAC name is N-(6-nitro-1,3-benzothiazol-2-yl)-2,2-diphenylacetamide.
| Compound Name | N-(6-nitro-1,3-benzothiazol-2-yl)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 2433919 |
| Molecular Formula | C21H15N3O3S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | N-(6-nitro-1,3-benzothiazol-2-yl)-2,2-diphenylacetamide |
| SMILES | O=C(Nc1nc2ccc([N+](=O)[O-])cc2s1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H15N3O3S/c25-20(19(14-7-3-1-4-8-14)15-9-5-2-6-10-15)23-21-22-17-12-11-16(24(26)27)13-18(17)28-21/h1-13,19H,(H,22,23,25) |
| InChIKey | APHRTNNTFILSFL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|