C18H12N4O5S — CID 19171353
2-(1,3-dioxoisoindol-2-yl)-N-(6-nitro-1,3-benzothiazol-2-yl)propanamide (PubChem CID 19171353) has the molecular formula C18H12N4O5S and a molecular weight of 396.38 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(6-nitro-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(6-nitro-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 19171353 |
| Molecular Formula | C18H12N4O5S |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(6-nitro-1,3-benzothiazol-2-yl)propanamide |
| SMILES | CC(C(=O)Nc1nc2ccc([N+](=O)[O-])cc2s1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H12N4O5S/c1-9(21-16(24)11-4-2-3-5-12(11)17(21)25)15(23)20-18-19-13-7-6-10(22(26)27)8-14(13)28-18/h2-9H,1H3,(H,19,20,23) |
| InChIKey | BLQNHJXIEBWVLP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|