C22H21N3O5S2 — CID 19174341
2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)pentanamide (PubChem CID 19174341) has the molecular formula C22H21N3O5S2 and a molecular weight of 471.56 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)pentanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 19174341 |
| Molecular Formula | C22H21N3O5S2 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)pentanamide |
| SMILES | CCC(C)C(C(=O)Nc1nc2ccc(S(C)(=O)=O)cc2s1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H21N3O5S2/c1-4-12(2)18(25-20(27)14-7-5-6-8-15(14)21(25)28)19(26)24-22-23-16-10-9-13(32(3,29)30)11-17(16)31-22/h5-12,18H,4H2,1-3H3,(H,23,24,26) |
| InChIKey | OJSQQRDUFZFJKD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|