C19H16N4O5S2 — CID 3508106
2-(1,3-dioxoisoindol-2-yl)-N-[6-(methylsulfamoyl)-1,3-benzothiazol-2-yl]propanamide (PubChem CID 3508106) has the molecular formula C19H16N4O5S2 and a molecular weight of 444.49 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[6-(methylsulfamoyl)-1,3-benzothiazol-2-yl]propanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[6-(methylsulfamoyl)-1,3-benzothiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 3508106 |
| Molecular Formula | C19H16N4O5S2 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[6-(methylsulfamoyl)-1,3-benzothiazol-2-yl]propanamide |
| SMILES | CNS(=O)(=O)c1ccc2nc(NC(=O)C(C)N3C(=O)c4ccccc4C3=O)sc2c1 |
| InChI | InChI=1S/C19H16N4O5S2/c1-10(23-17(25)12-5-3-4-6-13(12)18(23)26)16(24)22-19-21-14-8-7-11(9-15(14)29-19)30(27,28)20-2/h3-10,20H,1-2H3,(H,21,22,24) |
| InChIKey | COCCCFQHVBWYPL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|