C15H11Cl2N3O3S2 — CID 5082587
2,5-dichloro-N-[6-(methylsulfamoyl)-1,3-benzothiazol-2-yl]benzamide (PubChem CID 5082587) has the molecular formula C15H11Cl2N3O3S2 and a molecular weight of 416.31 g/mol. Its IUPAC name is 2,5-dichloro-N-[6-(methylsulfamoyl)-1,3-benzothiazol-2-yl]benzamide.
| Compound Name | 2,5-dichloro-N-[6-(methylsulfamoyl)-1,3-benzothiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 5082587 |
| Molecular Formula | C15H11Cl2N3O3S2 |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 414.96 |
| IUPAC Name | 2,5-dichloro-N-[6-(methylsulfamoyl)-1,3-benzothiazol-2-yl]benzamide |
| SMILES | CNS(=O)(=O)c1ccc2nc(NC(=O)c3cc(Cl)ccc3Cl)sc2c1 |
| InChI | InChI=1S/C15H11Cl2N3O3S2/c1-18-25(22,23)9-3-5-12-13(7-9)24-15(19-12)20-14(21)10-6-8(16)2-4-11(10)17/h2-7,18H,1H3,(H,19,20,21) |
| InChIKey | VDEXNCVAKGEXAP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |