C16H13ClN4O4S2 — CID 57422784
2-chloro-N-[[6-(methylsulfamoyl)-1,3-benzothiazol-2-yl]carbamoyl]benzamide (PubChem CID 57422784) has the molecular formula C16H13ClN4O4S2 and a molecular weight of 424.89 g/mol. Its IUPAC name is 2-chloro-N-[[6-(methylsulfamoyl)-1,3-benzothiazol-2-yl]carbamoyl]benzamide.
| Compound Name | 2-chloro-N-[[6-(methylsulfamoyl)-1,3-benzothiazol-2-yl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 57422784 |
| Molecular Formula | C16H13ClN4O4S2 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | 2-chloro-N-[[6-(methylsulfamoyl)-1,3-benzothiazol-2-yl]carbamoyl]benzamide |
| SMILES | CNS(=O)(=O)c1ccc2nc(NC(=O)NC(=O)c3ccccc3Cl)sc2c1 |
| InChI | InChI=1S/C16H13ClN4O4S2/c1-18-27(24,25)9-6-7-12-13(8-9)26-16(19-12)21-15(23)20-14(22)10-4-2-3-5-11(10)17/h2-8,18H,1H3,(H2,19,20,21,22,23) |
| InChIKey | SRMMDEMMNYEHEC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |