C20H21ClN4O5S2 — CID 25261384
2-chloro-N-[[6-[3-(2-hydroxyethylamino)propylsulfonyl]-1,3-benzothiazol-2-yl]carbamoyl]benzamide (PubChem CID 25261384) has the molecular formula C20H21ClN4O5S2 and a molecular weight of 497.00 g/mol. Its IUPAC name is 2-chloro-N-[[6-[3-(2-hydroxyethylamino)propylsulfonyl]-1,3-benzothiazol-2-yl]carbamoyl]benzamide.
| Compound Name | 2-chloro-N-[[6-[3-(2-hydroxyethylamino)propylsulfonyl]-1,3-benzothiazol-2-yl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 25261384 |
| Molecular Formula | C20H21ClN4O5S2 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | 2-chloro-N-[[6-[3-(2-hydroxyethylamino)propylsulfonyl]-1,3-benzothiazol-2-yl]carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1ccccc1Cl)Nc1nc2ccc(S(=O)(=O)CCCNCCO)cc2s1 |
| InChI | InChI=1S/C20H21ClN4O5S2/c21-15-5-2-1-4-14(15)18(27)24-19(28)25-20-23-16-7-6-13(12-17(16)31-20)32(29,30)11-3-8-22-9-10-26/h1-2,4-7,12,22,26H,3,8-11H2,(H2,23,24,25,27,28) |
| InChIKey | YNVXLSWXJAQDCE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 137.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|