C16H13ClN4O4S2 — CID 143788108
5-amino-2-chloro-N-[(6-methylsulfonyl-1,3-benzothiazol-2-yl)carbamoyl]benzamide (PubChem CID 143788108) has the molecular formula C16H13ClN4O4S2 and a molecular weight of 424.89 g/mol. Its IUPAC name is 5-amino-2-chloro-N-[(6-methylsulfonyl-1,3-benzothiazol-2-yl)carbamoyl]benzamide.
| Compound Name | 5-amino-2-chloro-N-[(6-methylsulfonyl-1,3-benzothiazol-2-yl)carbamoyl]benzamide |
|---|---|
| PubChem CID | 143788108 |
| Molecular Formula | C16H13ClN4O4S2 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | 5-amino-2-chloro-N-[(6-methylsulfonyl-1,3-benzothiazol-2-yl)carbamoyl]benzamide |
| SMILES | CS(=O)(=O)c1ccc2nc(NC(=O)NC(=O)c3cc(N)ccc3Cl)sc2c1 |
| InChI | InChI=1S/C16H13ClN4O4S2/c1-27(24,25)9-3-5-12-13(7-9)26-16(19-12)21-15(23)20-14(22)10-6-8(18)2-4-11(10)17/h2-7H,18H2,1H3,(H2,19,20,21,22,23) |
| InChIKey | LYFOQEPJAFKTJZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|