C16H13ClN4O6S3 — CID 174605122
[2-[(2-chloro-5-sulfamoylbenzoyl)carbamoylamino]-1,3-benzothiazol-6-yl]methanesulfinic acid (PubChem CID 174605122) has the molecular formula C16H13ClN4O6S3 and a molecular weight of 488.96 g/mol. Its IUPAC name is [2-[(2-chloro-5-sulfamoylbenzoyl)carbamoylamino]-1,3-benzothiazol-6-yl]methanesulfinic acid.
| Compound Name | [2-[(2-chloro-5-sulfamoylbenzoyl)carbamoylamino]-1,3-benzothiazol-6-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 174605122 |
| Molecular Formula | C16H13ClN4O6S3 |
| Molecular Weight | 488.96 g/mol |
| Exact Mass | 487.97 |
| IUPAC Name | [2-[(2-chloro-5-sulfamoylbenzoyl)carbamoylamino]-1,3-benzothiazol-6-yl]methanesulfinic acid |
| SMILES | NS(=O)(=O)c1ccc(Cl)c(C(=O)NC(=O)Nc2nc3ccc(CS(=O)O)cc3s2)c1 |
| InChI | InChI=1S/C16H13ClN4O6S3/c17-11-3-2-9(30(18,26)27)6-10(11)14(22)20-15(23)21-16-19-12-4-1-8(7-29(24)25)5-13(12)28-16/h1-6H,7H2,(H,24,25)(H2,18,26,27)(H2,19,20,21,22,23) |
| InChIKey | PGJSGPAZBHCYRX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 168.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.96 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|