C22H16FN3O4S2 — CID 174605135
[2-[[2-(4-fluorophenyl)benzoyl]carbamoylamino]-1,3-benzothiazol-6-yl]methanesulfinic acid (PubChem CID 174605135) has the molecular formula C22H16FN3O4S2 and a molecular weight of 469.52 g/mol. Its IUPAC name is [2-[[2-(4-fluorophenyl)benzoyl]carbamoylamino]-1,3-benzothiazol-6-yl]methanesulfinic acid.
| Compound Name | [2-[[2-(4-fluorophenyl)benzoyl]carbamoylamino]-1,3-benzothiazol-6-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 174605135 |
| Molecular Formula | C22H16FN3O4S2 |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | [2-[[2-(4-fluorophenyl)benzoyl]carbamoylamino]-1,3-benzothiazol-6-yl]methanesulfinic acid |
| SMILES | O=C(NC(=O)c1ccccc1-c1ccc(F)cc1)Nc1nc2ccc(CS(=O)O)cc2s1 |
| InChI | InChI=1S/C22H16FN3O4S2/c23-15-8-6-14(7-9-15)16-3-1-2-4-17(16)20(27)25-21(28)26-22-24-18-10-5-13(12-32(29)30)11-19(18)31-22/h1-11H,12H2,(H,29,30)(H2,24,25,26,27,28) |
| InChIKey | HQQXWWXDEBYNKP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|