C18H17FN2O2S — CID 18854016
2-butoxy-N-(6-fluoro-1,3-benzothiazol-2-yl)benzamide (PubChem CID 18854016) has the molecular formula C18H17FN2O2S and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-butoxy-N-(6-fluoro-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 2-butoxy-N-(6-fluoro-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 18854016 |
| Molecular Formula | C18H17FN2O2S |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2-butoxy-N-(6-fluoro-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCCCOc1ccccc1C(=O)Nc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C18H17FN2O2S/c1-2-3-10-23-15-7-5-4-6-13(15)17(22)21-18-20-14-9-8-12(19)11-16(14)24-18/h4-9,11H,2-3,10H2,1H3,(H,20,21,22) |
| InChIKey | FNQUIADKVXCUGC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|