C24H23N5O3S — CID 45272466
2-[3-(diaminomethylideneamino)propoxy]-N-(6-phenoxy-1,3-benzothiazol-2-yl)benzamide (PubChem CID 45272466) has the molecular formula C24H23N5O3S and a molecular weight of 461.55 g/mol. Its IUPAC name is 2-[3-(diaminomethylideneamino)propoxy]-N-(6-phenoxy-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 2-[3-(diaminomethylideneamino)propoxy]-N-(6-phenoxy-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 45272466 |
| Molecular Formula | C24H23N5O3S |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 2-[3-(diaminomethylideneamino)propoxy]-N-(6-phenoxy-1,3-benzothiazol-2-yl)benzamide |
| SMILES | NC(N)=NCCCOc1ccccc1C(=O)Nc1nc2ccc(Oc3ccccc3)cc2s1 |
| InChI | InChI=1S/C24H23N5O3S/c25-23(26)27-13-6-14-31-20-10-5-4-9-18(20)22(30)29-24-28-19-12-11-17(15-21(19)33-24)32-16-7-2-1-3-8-16/h1-5,7-12,15H,6,13-14H2,(H4,25,26,27)(H,28,29,30) |
| InChIKey | QBIFLSAZDLIDGI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 124.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|