C22H17N3O3S — CID 4063508
N-(6-acetamido-1,3-benzothiazol-2-yl)-2-phenoxybenzamide (PubChem CID 4063508) has the molecular formula C22H17N3O3S and a molecular weight of 403.46 g/mol. Its IUPAC name is N-(6-acetamido-1,3-benzothiazol-2-yl)-2-phenoxybenzamide.
| Compound Name | N-(6-acetamido-1,3-benzothiazol-2-yl)-2-phenoxybenzamide |
|---|---|
| PubChem CID | 4063508 |
| Molecular Formula | C22H17N3O3S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | N-(6-acetamido-1,3-benzothiazol-2-yl)-2-phenoxybenzamide |
| SMILES | CC(=O)Nc1ccc2nc(NC(=O)c3ccccc3Oc3ccccc3)sc2c1 |
| InChI | InChI=1S/C22H17N3O3S/c1-14(26)23-15-11-12-18-20(13-15)29-22(24-18)25-21(27)17-9-5-6-10-19(17)28-16-7-3-2-4-8-16/h2-13H,1H3,(H,23,26)(H,24,25,27) |
| InChIKey | TXKYFBGNHFLYTF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |