C17H15N3O4S2 — CID 7267001
N-(6-acetamido-1,3-benzothiazol-2-yl)-2-methylsulfonylbenzamide (PubChem CID 7267001) has the molecular formula C17H15N3O4S2 and a molecular weight of 389.46 g/mol. Its IUPAC name is N-(6-acetamido-1,3-benzothiazol-2-yl)-2-methylsulfonylbenzamide.
| Compound Name | N-(6-acetamido-1,3-benzothiazol-2-yl)-2-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 7267001 |
| Molecular Formula | C17H15N3O4S2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | N-(6-acetamido-1,3-benzothiazol-2-yl)-2-methylsulfonylbenzamide |
| SMILES | CC(=O)Nc1ccc2nc(NC(=O)c3ccccc3S(C)(=O)=O)sc2c1 |
| InChI | InChI=1S/C17H15N3O4S2/c1-10(21)18-11-7-8-13-14(9-11)25-17(19-13)20-16(22)12-5-3-4-6-15(12)26(2,23)24/h3-9H,1-2H3,(H,18,21)(H,19,20,22) |
| InChIKey | FTQBMQFSCLLATA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |