C16H13FN2O3S2 — CID 7578610
2-ethylsulfonyl-N-(6-fluoro-1,3-benzothiazol-2-yl)benzamide (PubChem CID 7578610) has the molecular formula C16H13FN2O3S2 and a molecular weight of 364.42 g/mol. Its IUPAC name is 2-ethylsulfonyl-N-(6-fluoro-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 2-ethylsulfonyl-N-(6-fluoro-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 7578610 |
| Molecular Formula | C16H13FN2O3S2 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 2-ethylsulfonyl-N-(6-fluoro-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)Nc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C16H13FN2O3S2/c1-2-24(21,22)14-6-4-3-5-11(14)15(20)19-16-18-12-8-7-10(17)9-13(12)23-16/h3-9H,2H2,1H3,(H,18,19,20) |
| InChIKey | GYSBGCDHLUEDPI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |