C20H15N3O4S — CID 17127300
N-[6-[(2-methoxybenzoyl)amino]-1,3-benzothiazol-2-yl]furan-2-carboxamide (PubChem CID 17127300) has the molecular formula C20H15N3O4S and a molecular weight of 393.42 g/mol. Its IUPAC name is N-[6-[(2-methoxybenzoyl)amino]-1,3-benzothiazol-2-yl]furan-2-carboxamide.
| Compound Name | N-[6-[(2-methoxybenzoyl)amino]-1,3-benzothiazol-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17127300 |
| Molecular Formula | C20H15N3O4S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | N-[6-[(2-methoxybenzoyl)amino]-1,3-benzothiazol-2-yl]furan-2-carboxamide |
| SMILES | COc1ccccc1C(=O)Nc1ccc2nc(NC(=O)c3ccco3)sc2c1 |
| InChI | InChI=1S/C20H15N3O4S/c1-26-15-6-3-2-5-13(15)18(24)21-12-8-9-14-17(11-12)28-20(22-14)23-19(25)16-7-4-10-27-16/h2-11H,1H3,(H,21,24)(H,22,23,25) |
| InChIKey | JUVGSSFKGVHCFN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |