C13H11N3O3S — CID 43548233
N-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)furan-2-carboxamide (PubChem CID 43548233) has the molecular formula C13H11N3O3S and a molecular weight of 289.32 g/mol. Its IUPAC name is N-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)furan-2-carboxamide.
| Compound Name | N-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 43548233 |
| Molecular Formula | C13H11N3O3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | N-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)furan-2-carboxamide |
| SMILES | COc1cc(N)cc2sc(NC(=O)c3ccco3)nc12 |
| InChI | InChI=1S/C13H11N3O3S/c1-18-9-5-7(14)6-10-11(9)15-13(20-10)16-12(17)8-3-2-4-19-8/h2-6H,14H2,1H3,(H,15,16,17) |
| InChIKey | UMABNJWCQHVSKG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|