C13H9ClN2O3S — CID 7590058
N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)furan-2-carboxamide (PubChem CID 7590058) has the molecular formula C13H9ClN2O3S and a molecular weight of 308.75 g/mol. Its IUPAC name is N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)furan-2-carboxamide.
| Compound Name | N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 7590058 |
| Molecular Formula | C13H9ClN2O3S |
| Molecular Weight | 308.75 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)furan-2-carboxamide |
| SMILES | COc1ccc(Cl)c2sc(NC(=O)c3ccco3)nc12 |
| InChI | InChI=1S/C13H9ClN2O3S/c1-18-8-5-4-7(14)11-10(8)15-13(20-11)16-12(17)9-3-2-6-19-9/h2-6H,1H3,(H,15,16,17) |
| InChIKey | ZMFMSDWOSMYVLH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.75 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |