C13H11ClN6O2S2 — CID 15050541
N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-2-(diaminomethylideneamino)-1,3-thiazole-4-carboxamide (PubChem CID 15050541) has the molecular formula C13H11ClN6O2S2 and a molecular weight of 382.86 g/mol. Its IUPAC name is N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-2-(diaminomethylideneamino)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-2-(diaminomethylideneamino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 15050541 |
| Molecular Formula | C13H11ClN6O2S2 |
| Molecular Weight | 382.86 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-2-(diaminomethylideneamino)-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(Cl)c2sc(NC(=O)c3csc(N=C(N)N)n3)nc12 |
| InChI | InChI=1S/C13H11ClN6O2S2/c1-22-7-3-2-5(14)9-8(7)18-13(24-9)19-10(21)6-4-23-12(17-6)20-11(15)16/h2-4H,1H3,(H,18,19,21)(H4,15,16,17,20) |
| InChIKey | QHPBQFZDPXBAIV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.86 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|