C13H12N6O2S2 — CID 15050506
2-(diaminomethylideneamino)-N-(4-methoxy-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 15050506) has the molecular formula C13H12N6O2S2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 2-(diaminomethylideneamino)-N-(4-methoxy-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(diaminomethylideneamino)-N-(4-methoxy-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 15050506 |
| Molecular Formula | C13H12N6O2S2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 2-(diaminomethylideneamino)-N-(4-methoxy-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | COc1cccc2sc(NC(=O)c3csc(N=C(N)N)n3)nc12 |
| InChI | InChI=1S/C13H12N6O2S2/c1-21-7-3-2-4-8-9(7)17-13(23-8)18-10(20)6-5-22-12(16-6)19-11(14)15/h2-5H,1H3,(H,17,18,20)(H4,14,15,16,19) |
| InChIKey | CHPBNALDDOQKLB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|