C18H15ClN6OS2 — CID 45260462
2-(diaminomethylideneamino)-N-(7-phenyl-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide;hydrochloride (PubChem CID 45260462) has the molecular formula C18H15ClN6OS2 and a molecular weight of 430.95 g/mol. Its IUPAC name is 2-(diaminomethylideneamino)-N-(7-phenyl-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide;hydrochloride.
| Compound Name | 2-(diaminomethylideneamino)-N-(7-phenyl-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 45260462 |
| Molecular Formula | C18H15ClN6OS2 |
| Molecular Weight | 430.95 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | 2-(diaminomethylideneamino)-N-(7-phenyl-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide;hydrochloride |
| SMILES | Cl.NC(N)=Nc1nc(C(=O)Nc2nc3cccc(-c4ccccc4)c3s2)cs1 |
| InChI | InChI=1S/C18H14N6OS2.ClH/c19-16(20)24-17-22-13(9-26-17)15(25)23-18-21-12-8-4-7-11(14(12)27-18)10-5-2-1-3-6-10;/h1-9H,(H,21,23,25)(H4,19,20,22,24);1H |
| InChIKey | ADVSEAPDECHORW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.95 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|