C7H9N5O3S — CID 18323037
2-[[2-(diaminomethylideneamino)-1,3-thiazole-4-carbonyl]amino]acetic acid (PubChem CID 18323037) has the molecular formula C7H9N5O3S and a molecular weight of 243.25 g/mol. Its IUPAC name is 2-[[2-(diaminomethylideneamino)-1,3-thiazole-4-carbonyl]amino]acetic acid.
| Compound Name | 2-[[2-(diaminomethylideneamino)-1,3-thiazole-4-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 18323037 |
| Molecular Formula | C7H9N5O3S |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 2-[[2-(diaminomethylideneamino)-1,3-thiazole-4-carbonyl]amino]acetic acid |
| SMILES | NC(N)=Nc1nc(C(=O)NCC(=O)O)cs1 |
| InChI | InChI=1S/C7H9N5O3S/c8-6(9)12-7-11-3(2-16-7)5(15)10-1-4(13)14/h2H,1H2,(H,10,15)(H,13,14)(H4,8,9,11,12) |
| InChIKey | ISGKRGOIDPYQOU-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 143.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|