C13H15N5OS — CID 10661107
N-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]methyl]acetamide (PubChem CID 10661107) has the molecular formula C13H15N5OS and a molecular weight of 289.36 g/mol. Its IUPAC name is N-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]methyl]acetamide.
| Compound Name | N-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 10661107 |
| Molecular Formula | C13H15N5OS |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(-c2csc(N=C(N)N)n2)cc1 |
| InChI | InChI=1S/C13H15N5OS/c1-8(19)16-6-9-2-4-10(5-3-9)11-7-20-13(17-11)18-12(14)15/h2-5,7H,6H2,1H3,(H,16,19)(H4,14,15,17,18) |
| InChIKey | WFIWSBGQQCNRKZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|