C10H14N4O — CID 59081490
N-[[4-(diaminomethylideneamino)phenyl]methyl]acetamide (PubChem CID 59081490) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is N-[[4-(diaminomethylideneamino)phenyl]methyl]acetamide.
| Compound Name | N-[[4-(diaminomethylideneamino)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 59081490 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | N-[[4-(diaminomethylideneamino)phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(N=C(N)N)cc1 |
| InChI | InChI=1S/C10H14N4O/c1-7(15)13-6-8-2-4-9(5-3-8)14-10(11)12/h2-5H,6H2,1H3,(H,13,15)(H4,11,12,14) |
| InChIKey | AHUIPHOADUNSRL-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|