C14H19F2N5O2 — CID 54212111
N-[(4S)-4-amino-5-[4-(diaminomethylideneamino)phenyl]-2,2-difluoro-3-oxopentyl]acetamide (PubChem CID 54212111) has the molecular formula C14H19F2N5O2 and a molecular weight of 327.34 g/mol. Its IUPAC name is N-[(4S)-4-amino-5-[4-(diaminomethylideneamino)phenyl]-2,2-difluoro-3-oxopentyl]acetamide.
| Compound Name | N-[(4S)-4-amino-5-[4-(diaminomethylideneamino)phenyl]-2,2-difluoro-3-oxopentyl]acetamide |
|---|---|
| PubChem CID | 54212111 |
| Molecular Formula | C14H19F2N5O2 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | N-[(4S)-4-amino-5-[4-(diaminomethylideneamino)phenyl]-2,2-difluoro-3-oxopentyl]acetamide |
| SMILES | CC(=O)NCC(F)(F)C(=O)[C@@H](N)Cc1ccc(N=C(N)N)cc1 |
| InChI | InChI=1S/C14H19F2N5O2/c1-8(22)20-7-14(15,16)12(23)11(17)6-9-2-4-10(5-3-9)21-13(18)19/h2-5,11H,6-7,17H2,1H3,(H,20,22)(H4,18,19,21)/t11-/m0/s1 |
| InChIKey | PWQMBINHVNCPFZ-NSHDSACASA-N |
| XLogP | -0.20 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|