C13H19NO2 — CID 70878581
2-amino-1-(4-hydroxyphenyl)-4,4-dimethylpentan-3-one (PubChem CID 70878581) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-amino-1-(4-hydroxyphenyl)-4,4-dimethylpentan-3-one.
| Compound Name | 2-amino-1-(4-hydroxyphenyl)-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 70878581 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-amino-1-(4-hydroxyphenyl)-4,4-dimethylpentan-3-one |
| SMILES | CC(C)(C)C(=O)C(N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C13H19NO2/c1-13(2,3)12(16)11(14)8-9-4-6-10(15)7-5-9/h4-7,11,15H,8,14H2,1-3H3 |
| InChIKey | JVTWUJDYLWWVIV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |