C12H18N2O3 — CID 139681701
2-aminopropan-2-yl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate (PubChem CID 139681701) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-aminopropan-2-yl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate.
| Compound Name | 2-aminopropan-2-yl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 139681701 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 2-aminopropan-2-yl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate |
| SMILES | CC(C)(N)OC(=O)[C@@H](N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C12H18N2O3/c1-12(2,14)17-11(16)10(13)7-8-3-5-9(15)6-4-8/h3-6,10,15H,7,13-14H2,1-2H3/t10-/m0/s1 |
| InChIKey | PGZAXBUJMGINEP-JTQLQIEISA-N |
| XLogP | 0.50 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|