C10H14N4O2 — CID 71409434
(2S)-2-amino-3-[4-(hydrazinylmethylideneamino)phenyl]propanoic acid (PubChem CID 71409434) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-(hydrazinylmethylideneamino)phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-(hydrazinylmethylideneamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 71409434 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | (2S)-2-amino-3-[4-(hydrazinylmethylideneamino)phenyl]propanoic acid |
| SMILES | NN/C=N/c1ccc(C[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C10H14N4O2/c11-9(10(15)16)5-7-1-3-8(4-2-7)13-6-14-12/h1-4,6,9H,5,11-12H2,(H,13,14)(H,15,16)/t9-/m0/s1 |
| InChIKey | CJZYIAVSOVFMRU-VIFPVBQESA-N |
| XLogP | -0.24 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|