C11H15N3O2 — CID 170656104
2-amino-3-[4-(ethyldiazenyl)phenyl]propanoic acid (PubChem CID 170656104) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-amino-3-[4-(ethyldiazenyl)phenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-(ethyldiazenyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 170656104 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-amino-3-[4-(ethyldiazenyl)phenyl]propanoic acid |
| SMILES | CC/N=N/c1ccc(CC(N)C(=O)O)cc1 |
| InChI | InChI=1S/C11H15N3O2/c1-2-13-14-9-5-3-8(4-6-9)7-10(12)11(15)16/h3-6,10H,2,7,12H2,1H3,(H,15,16)/b14-13+ |
| InChIKey | XNRIFJDLWXWBJZ-BUHFOSPRSA-N |
| XLogP | 1.74 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|